1,2-di(nonyl)-3-phenylbenzene;phosphonous acid

C30H49O2P — CID 70527839

IUPAC1,2-di(nonyl)-3-phenylbenzene;phosphonous acid
SMILESCCCCCCCCCc1cccc(-c2ccccc2)c1CCCCCCCCC.OPO
InChIInChI=1S/C30H46.H3O2P/c1-3-5-7-9-11-13-16-21-28-24-20-26-30(27-22-17-15-18-23-27)29(28)25-19-14-12-10-8-6-4-2;1-3-2/h15,17-18,20,22-24,26H,3-14,16,19,21,25H2,1-2H3;1-3H
InChIKeyVQQQLBSPOFJPCN-UHFFFAOYSA-N
MW472.69 g/mol
LogP9.42
Rot. Bonds17

About 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid

1,2-di(nonyl)-3-phenylbenzene;phosphonous acid (PubChem CID 70527839) has the molecular formula C30H49O2P and a molecular weight of 472.69 g/mol. Its IUPAC name is 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid.

Molecular Properties

Compound Name1,2-di(nonyl)-3-phenylbenzene;phosphonous acid
PubChem CID70527839
Molecular FormulaC30H49O2P
Molecular Weight472.69 g/mol
Exact Mass472.35
IUPAC Name1,2-di(nonyl)-3-phenylbenzene;phosphonous acid
SMILESCCCCCCCCCc1cccc(-c2ccccc2)c1CCCCCCCCC.OPO
InChIInChI=1S/C30H46.H3O2P/c1-3-5-7-9-11-13-16-21-28-24-20-26-30(27-22-17-15-18-23-27)29(28)25-19-14-12-10-8-6-4-2;1-3-2/h15,17-18,20,22-24,26H,3-14,16,19,21,25H2,1-2H3;1-3H
InChIKeyVQQQLBSPOFJPCN-UHFFFAOYSA-N
XLogP9.42
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds17
Heavy Atoms33
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500472.69
LogP ≤ 59.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid?
The IUPAC name of 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid (CID 70527839) is 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid.
What is the SMILES notation for 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid?
The canonical SMILES for 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid is CCCCCCCCCc1cccc(-c2ccccc2)c1CCCCCCCCC.OPO.
What is the InChIKey of 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid?
The InChIKey is VQQQLBSPOFJPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H46.H3O2P/c1-3-5-7-9-11-13-16-21-28-24-20-26-30(27-22-17-15-18-23-27)29(28)25-19-14-12-10-8-6-4-2;1-3-2/h15,17-18,20,22-24,26H,3-14,16,19,21,25H2,1-2H3;1-3H.
What are the key properties of 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid?
1,2-di(nonyl)-3-phenylbenzene;phosphonous acid has a molecular weight of 472.69 g/mol, XLogP of 9.42, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(nonyl)-3-phenylbenzene;phosphonous acid is sourced from PubChem (CID 70527839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).