About 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium
1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium (PubChem CID 174532098) has the molecular formula C16H20O3P+
and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium |
| PubChem CID | 174532098 |
| Molecular Formula | C16H20O3P+ |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium |
| SMILES | CCCCc1ccccc1-c1ccccc1.O=[P+](O)O |
| InChI | InChI=1S/C16H18.HO3P/c1-2-3-9-14-12-7-8-13-16(14)15-10-5-4-6-11-15;1-4(2)3/h4-8,10-13H,2-3,9H2,1H3;(H-,1,2,3)/p+1 |
| InChIKey | BNRMTMZLEIMVHE-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium?
The IUPAC name of 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium (CID 174532098) is 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium.
What is the SMILES notation for 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium?
The canonical SMILES for 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium is CCCCc1ccccc1-c1ccccc1.O=[P+](O)O.
What is the InChIKey of 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium?
The InChIKey is BNRMTMZLEIMVHE-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H18.HO3P/c1-2-3-9-14-12-7-8-13-16(14)15-10-5-4-6-11-15;1-4(2)3/h4-8,10-13H,2-3,9H2,1H3;(H-,1,2,3)/p+1.
What are the key properties of 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium?
1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium has a molecular weight of 291.31 g/mol, XLogP of 4.32, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-phenylbenzene;dihydroxy(oxo)phosphanium is sourced from PubChem (CID 174532098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).