C22H40O3P+ — CID 67709665
dihydroxy(oxo)phosphanium;1,2-dioctylbenzene (PubChem CID 67709665) has the molecular formula C22H40O3P+ and a molecular weight of 383.53 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1,2-dioctylbenzene.
| Compound Name | dihydroxy(oxo)phosphanium;1,2-dioctylbenzene |
|---|---|
| PubChem CID | 67709665 |
| Molecular Formula | C22H40O3P+ |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1,2-dioctylbenzene |
| SMILES | CCCCCCCCc1ccccc1CCCCCCCC.O=[P+](O)O |
| InChI | InChI=1S/C22H38.HO3P/c1-3-5-7-9-11-13-17-21-19-15-16-20-22(21)18-14-12-10-8-6-4-2;1-4(2)3/h15-16,19-20H,3-14,17-18H2,1-2H3;(H-,1,2,3)/p+1 |
| InChIKey | MTJWUFKEXDJAQX-UHFFFAOYSA-O |
| XLogP | 7.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|