About 1-propylazulene
1-propylazulene (PubChem CID 10397225) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-propylazulene.
Molecular Properties
| Compound Name | 1-propylazulene |
| PubChem CID | 10397225 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-propylazulene |
| SMILES | CCCc1ccc2cccccc1-2 |
| InChI | InChI=1S/C13H14/c1-2-6-11-9-10-12-7-4-3-5-8-13(11)12/h3-5,7-10H,2,6H2,1H3 |
| InChIKey | HYJHGLNFNVGVBH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-propylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylazulene?
The IUPAC name of 1-propylazulene (CID 10397225) is 1-propylazulene.
What is the SMILES notation for 1-propylazulene?
The canonical SMILES for 1-propylazulene is CCCc1ccc2cccccc1-2.
What is the InChIKey of 1-propylazulene?
The InChIKey is HYJHGLNFNVGVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-2-6-11-9-10-12-7-4-3-5-8-13(11)12/h3-5,7-10H,2,6H2,1H3.
What are the key properties of 1-propylazulene?
1-propylazulene has a molecular weight of 170.25 g/mol, XLogP of 3.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylazulene is sourced from PubChem (CID 10397225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).