About azulen-1-ylmethanethiol
azulen-1-ylmethanethiol (PubChem CID 90805831) has the molecular formula C11H10S
and a molecular weight of 174.27 g/mol. Its IUPAC name is azulen-1-ylmethanethiol.
Molecular Properties
| Compound Name | azulen-1-ylmethanethiol |
| PubChem CID | 90805831 |
| Molecular Formula | C11H10S |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | azulen-1-ylmethanethiol |
| SMILES | SCc1ccc2cccccc1-2 |
| InChI | InChI=1S/C11H10S/c12-8-10-7-6-9-4-2-1-3-5-11(9)10/h1-7,12H,8H2 |
| InChIKey | YLOPOMIMASMFQR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azulen-1-ylmethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulen-1-ylmethanethiol?
The IUPAC name of azulen-1-ylmethanethiol (CID 90805831) is azulen-1-ylmethanethiol.
What is the SMILES notation for azulen-1-ylmethanethiol?
The canonical SMILES for azulen-1-ylmethanethiol is SCc1ccc2cccccc1-2.
What is the InChIKey of azulen-1-ylmethanethiol?
The InChIKey is YLOPOMIMASMFQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10S/c12-8-10-7-6-9-4-2-1-3-5-11(9)10/h1-7,12H,8H2.
What are the key properties of azulen-1-ylmethanethiol?
azulen-1-ylmethanethiol has a molecular weight of 174.27 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azulen-1-ylmethanethiol is sourced from PubChem (CID 90805831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).