C17H20S — CID 10753589
5-(2-phenylphenyl)pentane-1-thiol (PubChem CID 10753589) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is 5-(2-phenylphenyl)pentane-1-thiol.
| Compound Name | 5-(2-phenylphenyl)pentane-1-thiol |
|---|---|
| PubChem CID | 10753589 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5-(2-phenylphenyl)pentane-1-thiol |
| SMILES | SCCCCCc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H20S/c18-14-8-2-5-11-16-12-6-7-13-17(16)15-9-3-1-4-10-15/h1,3-4,6-7,9-10,12-13,18H,2,5,8,11,14H2 |
| InChIKey | XIBWEJHNYHGXQR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|