About 1,1'-biphenyl;phenylmethanethiol
1,1'-biphenyl;phenylmethanethiol (PubChem CID 172707526) has the molecular formula C19H18S
and a molecular weight of 278.42 g/mol. Its IUPAC name is 1,1'-biphenyl;phenylmethanethiol.
Molecular Properties
| Compound Name | 1,1'-biphenyl;phenylmethanethiol |
| PubChem CID | 172707526 |
| Molecular Formula | C19H18S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1,1'-biphenyl;phenylmethanethiol |
| SMILES | SCc1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C7H8S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-5,8H,6H2 |
| InChIKey | DUGGMRFGUDMADD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;phenylmethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;phenylmethanethiol?
The IUPAC name of 1,1'-biphenyl;phenylmethanethiol (CID 172707526) is 1,1'-biphenyl;phenylmethanethiol.
What is the SMILES notation for 1,1'-biphenyl;phenylmethanethiol?
The canonical SMILES for 1,1'-biphenyl;phenylmethanethiol is SCc1ccccc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;phenylmethanethiol?
The InChIKey is DUGGMRFGUDMADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C7H8S/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10H;1-5,8H,6H2.
What are the key properties of 1,1'-biphenyl;phenylmethanethiol?
1,1'-biphenyl;phenylmethanethiol has a molecular weight of 278.42 g/mol, XLogP of 5.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;phenylmethanethiol is sourced from PubChem (CID 172707526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).