About CID 162140615
CID 162140615 (PubChem CID 162140615) has the molecular formula C12H10Cs
and a molecular weight of 287.12 g/mol.
Molecular Properties
| Compound Name | CID 162140615 |
| PubChem CID | 162140615 |
| Molecular Formula | C12H10Cs |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | — |
| SMILES | [Cs].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.Cs/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H; |
| InChIKey | ZJWMHSNFFGRPEO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 162140615 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162140615?
The IUPAC name of CID 162140615 (CID 162140615) is not available.
What is the SMILES notation for CID 162140615?
The canonical SMILES for CID 162140615 is [Cs].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of CID 162140615?
The InChIKey is ZJWMHSNFFGRPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.Cs/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;.
What are the key properties of CID 162140615?
CID 162140615 has a molecular weight of 287.12 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162140615 is sourced from PubChem (CID 162140615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).