C28H46 — CID 158550617
benzene;1,1'-biphenyl;ethane (PubChem CID 158550617) has the molecular formula C28H46 and a molecular weight of 382.68 g/mol. Its IUPAC name is benzene;1,1'-biphenyl;ethane.
| Compound Name | benzene;1,1'-biphenyl;ethane |
|---|---|
| PubChem CID | 158550617 |
| Molecular Formula | C28H46 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | benzene;1,1'-biphenyl;ethane |
| SMILES | CC.CC.CC.CC.CC.c1ccc(-c2ccccc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C12H10.C6H6.5C2H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-5-3-1;5*1-2/h1-10H;1-6H;5*1-2H3 |
| InChIKey | HPRBSODZKBLALP-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |