About 1,4-diphenylbenzene;ethane;methanamine
1,4-diphenylbenzene;ethane;methanamine (PubChem CID 168951795) has the molecular formula C21H25N
and a molecular weight of 291.44 g/mol. Its IUPAC name is 1,4-diphenylbenzene;ethane;methanamine.
Molecular Properties
| Compound Name | 1,4-diphenylbenzene;ethane;methanamine |
| PubChem CID | 168951795 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1,4-diphenylbenzene;ethane;methanamine |
| SMILES | CC.CN.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H14.C2H6.CH5N/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;2*1-2/h1-14H;1-2H3;2H2,1H3 |
| InChIKey | ZZDWAAFBXZREMW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-diphenylbenzene;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diphenylbenzene;ethane;methanamine?
The IUPAC name of 1,4-diphenylbenzene;ethane;methanamine (CID 168951795) is 1,4-diphenylbenzene;ethane;methanamine.
What is the SMILES notation for 1,4-diphenylbenzene;ethane;methanamine?
The canonical SMILES for 1,4-diphenylbenzene;ethane;methanamine is CC.CN.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of 1,4-diphenylbenzene;ethane;methanamine?
The InChIKey is ZZDWAAFBXZREMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14.C2H6.CH5N/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;2*1-2/h1-14H;1-2H3;2H2,1H3.
What are the key properties of 1,4-diphenylbenzene;ethane;methanamine?
1,4-diphenylbenzene;ethane;methanamine has a molecular weight of 291.44 g/mol, XLogP of 5.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diphenylbenzene;ethane;methanamine is sourced from PubChem (CID 168951795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).