C14H17Br — CID 90342014
1,1'-biphenyl;ethane;hydrobromide (PubChem CID 90342014) has the molecular formula C14H17Br and a molecular weight of 265.19 g/mol. Its IUPAC name is 1,1'-biphenyl;ethane;hydrobromide.
| Compound Name | 1,1'-biphenyl;ethane;hydrobromide |
|---|---|
| PubChem CID | 90342014 |
| Molecular Formula | C14H17Br |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1,1'-biphenyl;ethane;hydrobromide |
| SMILES | Br.CC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H6.BrH/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2;/h1-10H;1-2H3;1H |
| InChIKey | DZMUFNVKEFNRGE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |