C30H42 — CID 160802649
1,1'-biphenyl;ethane;naphthalene (PubChem CID 160802649) has the molecular formula C30H42 and a molecular weight of 402.67 g/mol. Its IUPAC name is 1,1'-biphenyl;ethane;naphthalene.
| Compound Name | 1,1'-biphenyl;ethane;naphthalene |
|---|---|
| PubChem CID | 160802649 |
| Molecular Formula | C30H42 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.33 |
| IUPAC Name | 1,1'-biphenyl;ethane;naphthalene |
| SMILES | CC.CC.CC.CC.c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10.C10H8.4C2H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;4*1-2/h1-10H;1-8H;4*1-2H3 |
| InChIKey | SDHBFQRWZZWJPX-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |