About ethane;naphthalene
ethane;naphthalene (PubChem CID 144512894) has the molecular formula C22H44
and a molecular weight of 308.59 g/mol. Its IUPAC name is ethane;naphthalene.
Molecular Properties
| Compound Name | ethane;naphthalene |
| PubChem CID | 144512894 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | ethane;naphthalene |
| SMILES | CC.CC.CC.CC.CC.CC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.6C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;6*1-2/h1-8H;6*1-2H3 |
| InChIKey | NEKLDFBYRVPXAG-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;naphthalene?
The IUPAC name of ethane;naphthalene (CID 144512894) is ethane;naphthalene.
What is the SMILES notation for ethane;naphthalene?
The canonical SMILES for ethane;naphthalene is CC.CC.CC.CC.CC.CC.c1ccc2ccccc2c1.
What is the InChIKey of ethane;naphthalene?
The InChIKey is NEKLDFBYRVPXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.6C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;6*1-2/h1-8H;6*1-2H3.
What are the key properties of ethane;naphthalene?
ethane;naphthalene has a molecular weight of 308.59 g/mol, XLogP of 9.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;naphthalene is sourced from PubChem (CID 144512894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).