About anthracene;ethane;naphthalene
anthracene;ethane;naphthalene (PubChem CID 159079166) has the molecular formula C32H42
and a molecular weight of 426.69 g/mol. Its IUPAC name is anthracene;ethane;naphthalene.
Molecular Properties
| Compound Name | anthracene;ethane;naphthalene |
| PubChem CID | 159079166 |
| Molecular Formula | C32H42 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | anthracene;ethane;naphthalene |
| SMILES | CC.CC.CC.CC.c1ccc2cc3ccccc3cc2c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H10.C10H8.4C2H6/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-6-10-8-4-3-7-9(10)5-1;4*1-2/h1-10H;1-8H;4*1-2H3 |
| InChIKey | KAQHLULBKDDDJW-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;ethane;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;ethane;naphthalene?
The IUPAC name of anthracene;ethane;naphthalene (CID 159079166) is anthracene;ethane;naphthalene.
What is the SMILES notation for anthracene;ethane;naphthalene?
The canonical SMILES for anthracene;ethane;naphthalene is CC.CC.CC.CC.c1ccc2cc3ccccc3cc2c1.c1ccc2ccccc2c1.
What is the InChIKey of anthracene;ethane;naphthalene?
The InChIKey is KAQHLULBKDDDJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C10H8.4C2H6/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-6-10-8-4-3-7-9(10)5-1;4*1-2/h1-10H;1-8H;4*1-2H3.
What are the key properties of anthracene;ethane;naphthalene?
anthracene;ethane;naphthalene has a molecular weight of 426.69 g/mol, XLogP of 10.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;ethane;naphthalene is sourced from PubChem (CID 159079166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).