About anthracene;silane
anthracene;silane (PubChem CID 131739126) has the molecular formula C14H14Si
and a molecular weight of 210.35 g/mol. Its IUPAC name is anthracene;silane.
Molecular Properties
| Compound Name | anthracene;silane |
| PubChem CID | 131739126 |
| Molecular Formula | C14H14Si |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | anthracene;silane |
| SMILES | [SiH4].c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.H4Si/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;/h1-10H;1H4 |
| InChIKey | KCRKHTIKXNQSOH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;silane?
The IUPAC name of anthracene;silane (CID 131739126) is anthracene;silane.
What is the SMILES notation for anthracene;silane?
The canonical SMILES for anthracene;silane is [SiH4].c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;silane?
The InChIKey is KCRKHTIKXNQSOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.H4Si/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;/h1-10H;1H4.
What are the key properties of anthracene;silane?
anthracene;silane has a molecular weight of 210.35 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;silane is sourced from PubChem (CID 131739126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).