About anthracene;2-methylpropane
anthracene;2-methylpropane (PubChem CID 142471530) has the molecular formula C18H20
and a molecular weight of 236.36 g/mol. Its IUPAC name is anthracene;2-methylpropane.
Molecular Properties
| Compound Name | anthracene;2-methylpropane |
| PubChem CID | 142471530 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | anthracene;2-methylpropane |
| SMILES | CC(C)C.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C4H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-4(2)3/h1-10H;4H,1-3H3 |
| InChIKey | SSQCCAPOYGRLGF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;2-methylpropane?
The IUPAC name of anthracene;2-methylpropane (CID 142471530) is anthracene;2-methylpropane.
What is the SMILES notation for anthracene;2-methylpropane?
The canonical SMILES for anthracene;2-methylpropane is CC(C)C.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;2-methylpropane?
The InChIKey is SSQCCAPOYGRLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C4H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-4(2)3/h1-10H;4H,1-3H3.
What are the key properties of anthracene;2-methylpropane?
anthracene;2-methylpropane has a molecular weight of 236.36 g/mol, XLogP of 5.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;2-methylpropane is sourced from PubChem (CID 142471530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).