About sodium;anthracene;hydride
sodium;anthracene;hydride (PubChem CID 173035649) has the molecular formula C14H11Na
and a molecular weight of 202.23 g/mol. Its IUPAC name is sodium;anthracene;hydride.
Molecular Properties
| Compound Name | sodium;anthracene;hydride |
| PubChem CID | 173035649 |
| Molecular Formula | C14H11Na |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | sodium;anthracene;hydride |
| SMILES | [H-].[Na+].c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.Na.H/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;;/h1-10H;;/q;+1;-1 |
| InChIKey | WIVCZJSEPDRDFX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;anthracene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;anthracene;hydride?
The IUPAC name of sodium;anthracene;hydride (CID 173035649) is sodium;anthracene;hydride.
What is the SMILES notation for sodium;anthracene;hydride?
The canonical SMILES for sodium;anthracene;hydride is [H-].[Na+].c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of sodium;anthracene;hydride?
The InChIKey is WIVCZJSEPDRDFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.Na.H/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;;/h1-10H;;/q;+1;-1.
What are the key properties of sodium;anthracene;hydride?
sodium;anthracene;hydride has a molecular weight of 202.23 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;anthracene;hydride is sourced from PubChem (CID 173035649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).