About gold;pentacene
gold;pentacene (PubChem CID 162013118) has the molecular formula C22H14Au
and a molecular weight of 475.32 g/mol. Its IUPAC name is gold;pentacene.
Molecular Properties
| Compound Name | gold;pentacene |
| PubChem CID | 162013118 |
| Molecular Formula | C22H14Au |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | gold;pentacene |
| SMILES | [Au].c1ccc2cc3cc4cc5ccccc5cc4cc3cc2c1 |
| InChI | InChI=1S/C22H14.Au/c1-2-6-16-10-20-14-22-12-18-8-4-3-7-17(18)11-21(22)13-19(20)9-15(16)5-1;/h1-14H; |
| InChIKey | YTSWYTJUJOLKCZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze gold;pentacene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;pentacene?
The IUPAC name of gold;pentacene (CID 162013118) is gold;pentacene.
What is the SMILES notation for gold;pentacene?
The canonical SMILES for gold;pentacene is [Au].c1ccc2cc3cc4cc5ccccc5cc4cc3cc2c1.
What is the InChIKey of gold;pentacene?
The InChIKey is YTSWYTJUJOLKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14.Au/c1-2-6-16-10-20-14-22-12-18-8-4-3-7-17(18)11-21(22)13-19(20)9-15(16)5-1;/h1-14H;.
What are the key properties of gold;pentacene?
gold;pentacene has a molecular weight of 475.32 g/mol, XLogP of 6.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold;pentacene is sourced from PubChem (CID 162013118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).