About tetrakis(methanediimine);tetracene
tetrakis(methanediimine);tetracene (PubChem CID 175029829) has the molecular formula C22H20N8
and a molecular weight of 396.46 g/mol. Its IUPAC name is tetrakis(methanediimine);tetracene.
Molecular Properties
| Compound Name | tetrakis(methanediimine);tetracene |
| PubChem CID | 175029829 |
| Molecular Formula | C22H20N8 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | tetrakis(methanediimine);tetracene |
| SMILES | N=C=N.N=C=N.N=C=N.N=C=N.c1ccc2cc3cc4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C18H12.4CH2N2/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1;4*2-1-3/h1-12H;4*2-3H |
| InChIKey | KGZCGWWCJBVHJM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(methanediimine);tetracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(methanediimine);tetracene?
The IUPAC name of tetrakis(methanediimine);tetracene (CID 175029829) is tetrakis(methanediimine);tetracene.
What is the SMILES notation for tetrakis(methanediimine);tetracene?
The canonical SMILES for tetrakis(methanediimine);tetracene is N=C=N.N=C=N.N=C=N.N=C=N.c1ccc2cc3cc4ccccc4cc3cc2c1.
What is the InChIKey of tetrakis(methanediimine);tetracene?
The InChIKey is KGZCGWWCJBVHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.4CH2N2/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1;4*2-1-3/h1-12H;4*2-3H.
What are the key properties of tetrakis(methanediimine);tetracene?
tetrakis(methanediimine);tetracene has a molecular weight of 396.46 g/mol, XLogP of 6.42, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(methanediimine);tetracene is sourced from PubChem (CID 175029829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).