About hexane;isocyanic acid;tetracene
hexane;isocyanic acid;tetracene (PubChem CID 175299920) has the molecular formula C28H30N4O4
and a molecular weight of 486.57 g/mol. Its IUPAC name is hexane;isocyanic acid;tetracene.
Molecular Properties
| Compound Name | hexane;isocyanic acid;tetracene |
| PubChem CID | 175299920 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | hexane;isocyanic acid;tetracene |
| SMILES | CCCCCC.N=C=O.N=C=O.N=C=O.N=C=O.c1ccc2cc3cc4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C18H12.C6H14.4CHNO/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1;1-3-5-6-4-2;4*2-1-3/h1-12H;3-6H2,1-2H3;4*2H |
| InChIKey | QGNBFRZIMKITQV-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze hexane;isocyanic acid;tetracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;isocyanic acid;tetracene?
The IUPAC name of hexane;isocyanic acid;tetracene (CID 175299920) is hexane;isocyanic acid;tetracene.
What is the SMILES notation for hexane;isocyanic acid;tetracene?
The canonical SMILES for hexane;isocyanic acid;tetracene is CCCCCC.N=C=O.N=C=O.N=C=O.N=C=O.c1ccc2cc3cc4ccccc4cc3cc2c1.
What is the InChIKey of hexane;isocyanic acid;tetracene?
The InChIKey is QGNBFRZIMKITQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.C6H14.4CHNO/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1;1-3-5-6-4-2;4*2-1-3/h1-12H;3-6H2,1-2H3;4*2H.
What are the key properties of hexane;isocyanic acid;tetracene?
hexane;isocyanic acid;tetracene has a molecular weight of 486.57 g/mol, XLogP of 7.34, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;isocyanic acid;tetracene is sourced from PubChem (CID 175299920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).