About anthracene;hexan-1-ol
anthracene;hexan-1-ol (PubChem CID 174457209) has the molecular formula C20H24O
and a molecular weight of 280.41 g/mol. Its IUPAC name is anthracene;hexan-1-ol.
Molecular Properties
| Compound Name | anthracene;hexan-1-ol |
| PubChem CID | 174457209 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | anthracene;hexan-1-ol |
| SMILES | CCCCCCO.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C6H14O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-3-4-5-6-7/h1-10H;7H,2-6H2,1H3 |
| InChIKey | ZBKSEIORHJIPNL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;hexan-1-ol?
The IUPAC name of anthracene;hexan-1-ol (CID 174457209) is anthracene;hexan-1-ol.
What is the SMILES notation for anthracene;hexan-1-ol?
The canonical SMILES for anthracene;hexan-1-ol is CCCCCCO.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;hexan-1-ol?
The InChIKey is ZBKSEIORHJIPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C6H14O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-3-4-5-6-7/h1-10H;7H,2-6H2,1H3.
What are the key properties of anthracene;hexan-1-ol?
anthracene;hexan-1-ol has a molecular weight of 280.41 g/mol, XLogP of 5.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;hexan-1-ol is sourced from PubChem (CID 174457209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).