About anthracene;ethanol;titanium
anthracene;ethanol;titanium (PubChem CID 160763576) has the molecular formula C16H16OTi
and a molecular weight of 272.17 g/mol. Its IUPAC name is anthracene;ethanol;titanium.
Molecular Properties
| Compound Name | anthracene;ethanol;titanium |
| PubChem CID | 160763576 |
| Molecular Formula | C16H16OTi |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | anthracene;ethanol;titanium |
| SMILES | CCO.[Ti].c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C2H6O.Ti/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-3;/h1-10H;3H,2H2,1H3; |
| InChIKey | OAGQCBPGAVJCBL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;ethanol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;ethanol;titanium?
The IUPAC name of anthracene;ethanol;titanium (CID 160763576) is anthracene;ethanol;titanium.
What is the SMILES notation for anthracene;ethanol;titanium?
The canonical SMILES for anthracene;ethanol;titanium is CCO.[Ti].c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;ethanol;titanium?
The InChIKey is OAGQCBPGAVJCBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C2H6O.Ti/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-3;/h1-10H;3H,2H2,1H3;.
What are the key properties of anthracene;ethanol;titanium?
anthracene;ethanol;titanium has a molecular weight of 272.17 g/mol, XLogP of 3.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;ethanol;titanium is sourced from PubChem (CID 160763576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).