About anthracene;(E)-hex-3-ene;propane
anthracene;(E)-hex-3-ene;propane (PubChem CID 144562643) has the molecular formula C26H38
and a molecular weight of 350.59 g/mol. Its IUPAC name is anthracene;(E)-hex-3-ene;propane.
Molecular Properties
| Compound Name | anthracene;(E)-hex-3-ene;propane |
| PubChem CID | 144562643 |
| Molecular Formula | C26H38 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | anthracene;(E)-hex-3-ene;propane |
| SMILES | CC/C=C/CC.CCC.CCC.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C6H12.2C3H8/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-5-6-4-2;2*1-3-2/h1-10H;5-6H,3-4H2,1-2H3;2*3H2,1-2H3/b;6-5+;; |
| InChIKey | YIECTZYIFMSKFO-BWVIBOQJSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;(E)-hex-3-ene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;(E)-hex-3-ene;propane?
The IUPAC name of anthracene;(E)-hex-3-ene;propane (CID 144562643) is anthracene;(E)-hex-3-ene;propane.
What is the SMILES notation for anthracene;(E)-hex-3-ene;propane?
The canonical SMILES for anthracene;(E)-hex-3-ene;propane is CC/C=C/CC.CCC.CCC.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;(E)-hex-3-ene;propane?
The InChIKey is YIECTZYIFMSKFO-BWVIBOQJSA-N. The full InChI is InChI=1S/C14H10.C6H12.2C3H8/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-3-5-6-4-2;2*1-3-2/h1-10H;5-6H,3-4H2,1-2H3;2*3H2,1-2H3/b;6-5+;;.
What are the key properties of anthracene;(E)-hex-3-ene;propane?
anthracene;(E)-hex-3-ene;propane has a molecular weight of 350.59 g/mol, XLogP of 9.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;(E)-hex-3-ene;propane is sourced from PubChem (CID 144562643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).