C14H18 — CID 140975855
1,2-bis(but-1-enyl)benzene (PubChem CID 140975855) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,2-bis(but-1-enyl)benzene.
| Compound Name | 1,2-bis(but-1-enyl)benzene |
|---|---|
| PubChem CID | 140975855 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1,2-bis(but-1-enyl)benzene |
| SMILES | CCC=Cc1ccccc1C=CCC |
| InChI | InChI=1S/C14H18/c1-3-5-9-13-11-7-8-12-14(13)10-6-4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | QBRJAWZYIUXCMU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |