About 4-but-1-enyldibenzofuran
4-but-1-enyldibenzofuran (PubChem CID 154131929) has the molecular formula C16H14O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-but-1-enyldibenzofuran.
Molecular Properties
| Compound Name | 4-but-1-enyldibenzofuran |
| PubChem CID | 154131929 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-but-1-enyldibenzofuran |
| SMILES | CCC=Cc1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C16H14O/c1-2-3-7-12-8-6-10-14-13-9-4-5-11-15(13)17-16(12)14/h3-11H,2H2,1H3 |
| InChIKey | CWFGUOPHPPPEPY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-but-1-enyldibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-1-enyldibenzofuran?
The IUPAC name of 4-but-1-enyldibenzofuran (CID 154131929) is 4-but-1-enyldibenzofuran.
What is the SMILES notation for 4-but-1-enyldibenzofuran?
The canonical SMILES for 4-but-1-enyldibenzofuran is CCC=Cc1cccc2c1oc1ccccc12.
What is the InChIKey of 4-but-1-enyldibenzofuran?
The InChIKey is CWFGUOPHPPPEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O/c1-2-3-7-12-8-6-10-14-13-9-4-5-11-15(13)17-16(12)14/h3-11H,2H2,1H3.
What are the key properties of 4-but-1-enyldibenzofuran?
4-but-1-enyldibenzofuran has a molecular weight of 222.29 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-1-enyldibenzofuran is sourced from PubChem (CID 154131929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).