About dibenzofuran;ethanol
dibenzofuran;ethanol (PubChem CID 174821059) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is dibenzofuran;ethanol.
Molecular Properties
| Compound Name | dibenzofuran;ethanol |
| PubChem CID | 174821059 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | dibenzofuran;ethanol |
| SMILES | CCO.c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H8O.C2H6O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-3/h1-8H;3H,2H2,1H3 |
| InChIKey | GPIFCCNLEBAIMJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dibenzofuran;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran;ethanol?
The IUPAC name of dibenzofuran;ethanol (CID 174821059) is dibenzofuran;ethanol.
What is the SMILES notation for dibenzofuran;ethanol?
The canonical SMILES for dibenzofuran;ethanol is CCO.c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran;ethanol?
The InChIKey is GPIFCCNLEBAIMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.C2H6O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-3/h1-8H;3H,2H2,1H3.
What are the key properties of dibenzofuran;ethanol?
dibenzofuran;ethanol has a molecular weight of 214.26 g/mol, XLogP of 3.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran;ethanol is sourced from PubChem (CID 174821059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).