About dibenzofuran;dihydrate;dihydrochloride
dibenzofuran;dihydrate;dihydrochloride (PubChem CID 21327105) has the molecular formula C12H14Cl2O3
and a molecular weight of 277.15 g/mol. Its IUPAC name is dibenzofuran;dihydrate;dihydrochloride.
Molecular Properties
| Compound Name | dibenzofuran;dihydrate;dihydrochloride |
| PubChem CID | 21327105 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | dibenzofuran;dihydrate;dihydrochloride |
| SMILES | Cl.Cl.O.O.c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H8O.2ClH.2H2O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;;/h1-8H;2*1H;2*1H2 |
| InChIKey | SWOWOQSPDCWTHJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibenzofuran;dihydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran;dihydrate;dihydrochloride?
The IUPAC name of dibenzofuran;dihydrate;dihydrochloride (CID 21327105) is dibenzofuran;dihydrate;dihydrochloride.
What is the SMILES notation for dibenzofuran;dihydrate;dihydrochloride?
The canonical SMILES for dibenzofuran;dihydrate;dihydrochloride is Cl.Cl.O.O.c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran;dihydrate;dihydrochloride?
The InChIKey is SWOWOQSPDCWTHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.2ClH.2H2O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;;;;/h1-8H;2*1H;2*1H2.
What are the key properties of dibenzofuran;dihydrate;dihydrochloride?
dibenzofuran;dihydrate;dihydrochloride has a molecular weight of 277.15 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran;dihydrate;dihydrochloride is sourced from PubChem (CID 21327105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).