About dibenzofuran-2-amine
dibenzofuran-2-amine (PubChem CID 19405) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is dibenzofuran-2-amine.
Molecular Properties
| Compound Name | dibenzofuran-2-amine |
| PubChem CID | 19405 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | dibenzofuran-2-amine |
| SMILES | Nc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C12H9NO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H,13H2 |
| InChIKey | FFYZMBQLAYDJIG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dibenzofuran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-2-amine?
The IUPAC name of dibenzofuran-2-amine (CID 19405) is dibenzofuran-2-amine.
What is the SMILES notation for dibenzofuran-2-amine?
The canonical SMILES for dibenzofuran-2-amine is Nc1ccc2oc3ccccc3c2c1.
What is the InChIKey of dibenzofuran-2-amine?
The InChIKey is FFYZMBQLAYDJIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H,13H2.
What are the key properties of dibenzofuran-2-amine?
dibenzofuran-2-amine has a molecular weight of 183.21 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-2-amine is sourced from PubChem (CID 19405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).