About 2-bromodibenzofuran;naphthalen-2-amine
2-bromodibenzofuran;naphthalen-2-amine (PubChem CID 175083033) has the molecular formula C22H16BrNO
and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-bromodibenzofuran;naphthalen-2-amine.
Molecular Properties
| Compound Name | 2-bromodibenzofuran;naphthalen-2-amine |
| PubChem CID | 175083033 |
| Molecular Formula | C22H16BrNO |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-bromodibenzofuran;naphthalen-2-amine |
| SMILES | Brc1ccc2oc3ccccc3c2c1.Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H7BrO.C10H9N/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H;1-7H,11H2 |
| InChIKey | NPRFXSADJSLTLZ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromodibenzofuran;naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromodibenzofuran;naphthalen-2-amine?
The IUPAC name of 2-bromodibenzofuran;naphthalen-2-amine (CID 175083033) is 2-bromodibenzofuran;naphthalen-2-amine.
What is the SMILES notation for 2-bromodibenzofuran;naphthalen-2-amine?
The canonical SMILES for 2-bromodibenzofuran;naphthalen-2-amine is Brc1ccc2oc3ccccc3c2c1.Nc1ccc2ccccc2c1.
What is the InChIKey of 2-bromodibenzofuran;naphthalen-2-amine?
The InChIKey is NPRFXSADJSLTLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrO.C10H9N/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H;1-7H,11H2.
What are the key properties of 2-bromodibenzofuran;naphthalen-2-amine?
2-bromodibenzofuran;naphthalen-2-amine has a molecular weight of 390.28 g/mol, XLogP of 6.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromodibenzofuran;naphthalen-2-amine is sourced from PubChem (CID 175083033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).