About dibenzofuran;molecular hydrogen
dibenzofuran;molecular hydrogen (PubChem CID 173065186) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is dibenzofuran;molecular hydrogen.
Molecular Properties
| Compound Name | dibenzofuran;molecular hydrogen |
| PubChem CID | 173065186 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | dibenzofuran;molecular hydrogen |
| SMILES | [H][H].c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H8O.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H |
| InChIKey | CBQVLBFEEPEARL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibenzofuran;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran;molecular hydrogen?
The IUPAC name of dibenzofuran;molecular hydrogen (CID 173065186) is dibenzofuran;molecular hydrogen.
What is the SMILES notation for dibenzofuran;molecular hydrogen?
The canonical SMILES for dibenzofuran;molecular hydrogen is [H][H].c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran;molecular hydrogen?
The InChIKey is CBQVLBFEEPEARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H.
What are the key properties of dibenzofuran;molecular hydrogen?
dibenzofuran;molecular hydrogen has a molecular weight of 170.21 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran;molecular hydrogen is sourced from PubChem (CID 173065186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).