dibenzofuran;molecular hydrogen

C12H10O — CID 173065186

IUPACdibenzofuran;molecular hydrogen
SMILES[H][H].c1ccc2c(c1)oc1ccccc12
InChIInChI=1S/C12H8O.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H
InChIKeyCBQVLBFEEPEARL-UHFFFAOYSA-N
MW170.21 g/mol
LogP3.83
Rot. Bonds

About dibenzofuran;molecular hydrogen

dibenzofuran;molecular hydrogen (PubChem CID 173065186) has the molecular formula C12H10O and a molecular weight of 170.21 g/mol. Its IUPAC name is dibenzofuran;molecular hydrogen.

Molecular Properties

Compound Namedibenzofuran;molecular hydrogen
PubChem CID173065186
Molecular FormulaC12H10O
Molecular Weight170.21 g/mol
Exact Mass170.07
IUPAC Namedibenzofuran;molecular hydrogen
SMILES[H][H].c1ccc2c(c1)oc1ccccc12
InChIInChI=1S/C12H8O.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H
InChIKeyCBQVLBFEEPEARL-UHFFFAOYSA-N
XLogP3.83
TPSA13.14 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 53.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze dibenzofuran;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dibenzofuran;molecular hydrogen?
The IUPAC name of dibenzofuran;molecular hydrogen (CID 173065186) is dibenzofuran;molecular hydrogen.
What is the SMILES notation for dibenzofuran;molecular hydrogen?
The canonical SMILES for dibenzofuran;molecular hydrogen is [H][H].c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran;molecular hydrogen?
The InChIKey is CBQVLBFEEPEARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.H2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H.
What are the key properties of dibenzofuran;molecular hydrogen?
dibenzofuran;molecular hydrogen has a molecular weight of 170.21 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran;molecular hydrogen is sourced from PubChem (CID 173065186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).