About 2-deuteriodibenzofuran
2-deuteriodibenzofuran (PubChem CID 90735776) has the molecular formula C12H8O
and a molecular weight of 169.20 g/mol. Its IUPAC name is 2-deuteriodibenzofuran.
Molecular Properties
| Compound Name | 2-deuteriodibenzofuran |
| PubChem CID | 90735776 |
| Molecular Formula | C12H8O |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2-deuteriodibenzofuran |
| SMILES | [2H]c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H/i1D |
| InChIKey | TXCDCPKCNAJMEE-MICDWDOJSA-N |
| XLogP | 3.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-deuteriodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuteriodibenzofuran?
The IUPAC name of 2-deuteriodibenzofuran (CID 90735776) is 2-deuteriodibenzofuran.
What is the SMILES notation for 2-deuteriodibenzofuran?
The canonical SMILES for 2-deuteriodibenzofuran is [2H]c1ccc2oc3ccccc3c2c1.
What is the InChIKey of 2-deuteriodibenzofuran?
The InChIKey is TXCDCPKCNAJMEE-MICDWDOJSA-N. The full InChI is InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H/i1D.
What are the key properties of 2-deuteriodibenzofuran?
2-deuteriodibenzofuran has a molecular weight of 169.20 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuteriodibenzofuran is sourced from PubChem (CID 90735776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).