C12H10N2O — CID 21425844
dibenzofuran-1,2-diamine (PubChem CID 21425844) has the molecular formula C12H10N2O and a molecular weight of 198.23 g/mol. Its IUPAC name is dibenzofuran-1,2-diamine.
| Compound Name | dibenzofuran-1,2-diamine |
|---|---|
| PubChem CID | 21425844 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | dibenzofuran-1,2-diamine |
| SMILES | Nc1ccc2oc3ccccc3c2c1N |
| InChI | InChI=1S/C12H10N2O/c13-8-5-6-10-11(12(8)14)7-3-1-2-4-9(7)15-10/h1-6H,13-14H2 |
| InChIKey | OLUOPPIKGNVRRJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|