C13H12N2O — CID 68822096
3-methyldibenzofuran-1,4-diamine (PubChem CID 68822096) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-methyldibenzofuran-1,4-diamine.
| Compound Name | 3-methyldibenzofuran-1,4-diamine |
|---|---|
| PubChem CID | 68822096 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3-methyldibenzofuran-1,4-diamine |
| SMILES | Cc1cc(N)c2c(oc3ccccc32)c1N |
| InChI | InChI=1S/C13H12N2O/c1-7-6-9(14)11-8-4-2-3-5-10(8)16-13(11)12(7)15/h2-6H,14-15H2,1H3 |
| InChIKey | BWZSIJHGEIXMAV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|