C19H15NOS2 — CID 142290538
CID 142290538 (PubChem CID 142290538) has the molecular formula C19H15NOS2 and a molecular weight of 337.47 g/mol.
| Compound Name | CID 142290538 |
|---|---|
| PubChem CID | 142290538 |
| Molecular Formula | C19H15NOS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | — |
| SMILES | Cc1cc2c3ccccc3[nH]c2c2c1oc1ccccc12.SS |
| InChI | InChI=1S/C19H13NO.H2S2/c1-11-10-14-12-6-2-4-8-15(12)20-18(14)17-13-7-3-5-9-16(13)21-19(11)17;1-2/h2-10,20H,1H3;1-2H |
| InChIKey | RQQOHIRUNQSMCA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|