C20H17NO — CID 167453025
12H-[1]benzofuro[3,2-a]carbazole;ethane (PubChem CID 167453025) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is 12H-[1]benzofuro[3,2-a]carbazole;ethane.
| Compound Name | 12H-[1]benzofuro[3,2-a]carbazole;ethane |
|---|---|
| PubChem CID | 167453025 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 12H-[1]benzofuro[3,2-a]carbazole;ethane |
| SMILES | CC.c1ccc2c(c1)[nH]c1c2ccc2oc3ccccc3c21 |
| InChI | InChI=1S/C18H11NO.C2H6/c1-3-7-14-11(5-1)12-9-10-16-17(18(12)19-14)13-6-2-4-8-15(13)20-16;1-2/h1-10,19H;1-2H3 |
| InChIKey | ZTRKUPOZOJVSOB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |