C18H15NO — CID 167453493
3-methyl-2-[(Z)-prop-1-enyl]-1H-[1]benzofuro[2,3-g]indole (PubChem CID 167453493) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-methyl-2-[(Z)-prop-1-enyl]-1H-[1]benzofuro[2,3-g]indole.
| Compound Name | 3-methyl-2-[(Z)-prop-1-enyl]-1H-[1]benzofuro[2,3-g]indole |
|---|---|
| PubChem CID | 167453493 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-methyl-2-[(Z)-prop-1-enyl]-1H-[1]benzofuro[2,3-g]indole |
| SMILES | C/C=C\c1[nH]c2c(ccc3oc4ccccc4c32)c1C |
| InChI | InChI=1S/C18H15NO/c1-3-6-14-11(2)12-9-10-16-17(18(12)19-14)13-7-4-5-8-15(13)20-16/h3-10,19H,1-2H3/b6-3- |
| InChIKey | GKOQCOZVIDTEPV-UTCJRWHESA-N |
| XLogP | 5.41 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |