C24H10B5NO — CID 174076879
CID 174076879 (PubChem CID 174076879) has the molecular formula C24H10B5NO and a molecular weight of 382.41 g/mol.
| Compound Name | CID 174076879 |
|---|---|
| PubChem CID | 174076879 |
| Molecular Formula | C24H10B5NO |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc3[nH]c4c(ccc5oc6ccccc6c54)c3c2)c([B])c1[B] |
| InChI | InChI=1S/C24H10B5NO/c25-19-17(20(26)22(28)23(29)21(19)27)10-5-7-14-13(9-10)11-6-8-16-18(24(11)30-14)12-3-1-2-4-15(12)31-16/h1-9,30H |
| InChIKey | CKVMNMMTCOHINH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|