C48H23B7O — CID 168994111
CID 168994111 (PubChem CID 168994111) has the molecular formula C48H23B7O and a molecular weight of 691.40 g/mol.
| Compound Name | CID 168994111 |
|---|---|
| PubChem CID | 168994111 |
| Molecular Formula | C48H23B7O |
| Molecular Weight | 691.40 g/mol |
| Exact Mass | 692.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(-c3ccc(-c4ccc5ccccc5c4)cc3)c3c([B])c(-c4ccccc4)c([B])c([B])c3c(-c3ccc4oc5ccccc5c4c3)c2c1[B] |
| InChI | InChI=1S/C48H23B7O/c49-42-37(26-9-2-1-3-10-26)43(50)44(51)40-36(30-20-21-34-32(23-30)31-12-6-7-13-33(31)56-34)41-39(45(52)47(54)48(55)46(41)53)35(38(40)42)27-17-14-25(15-18-27)29-19-16-24-8-4-5-11-28(24)22-29/h1-23H |
| InChIKey | WWLIUQCFFQWKJS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|