C42H24B2O7 — CID 170723482
CID 170723482 (PubChem CID 170723482) has the molecular formula C42H24B2O7 and a molecular weight of 662.27 g/mol.
| Compound Name | CID 170723482 |
|---|---|
| PubChem CID | 170723482 |
| Molecular Formula | C42H24B2O7 |
| Molecular Weight | 662.27 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(O)c2c(-c3ccc4oc5ccccc5c4c3)c3c(O)c(O)c(O)c(O)c3c(-c3ccc(-c4ccc5ccccc5c4)cc3)c2c1O |
| InChI | InChI=1S/C42H24B2O7/c43-35-36(44)38(46)32-30(24-15-16-28-26(18-24)25-7-3-4-8-27(25)51-28)34-33(39(47)41(49)42(50)40(34)48)29(31(32)37(35)45)21-12-9-20(10-13-21)23-14-11-19-5-1-2-6-22(19)17-23/h1-18,45-50H |
| InChIKey | ZGNJODZGSIUZKM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.27 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|