About dibenzofuran;hydrofluoride
dibenzofuran;hydrofluoride (PubChem CID 158307405) has the molecular formula C12H9FO
and a molecular weight of 188.20 g/mol. Its IUPAC name is dibenzofuran;hydrofluoride.
Molecular Properties
| Compound Name | dibenzofuran;hydrofluoride |
| PubChem CID | 158307405 |
| Molecular Formula | C12H9FO |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | dibenzofuran;hydrofluoride |
| SMILES | F.c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H8O.FH/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H |
| InChIKey | ZJKIIZKKJPRTMJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibenzofuran;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran;hydrofluoride?
The IUPAC name of dibenzofuran;hydrofluoride (CID 158307405) is dibenzofuran;hydrofluoride.
What is the SMILES notation for dibenzofuran;hydrofluoride?
The canonical SMILES for dibenzofuran;hydrofluoride is F.c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran;hydrofluoride?
The InChIKey is ZJKIIZKKJPRTMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.FH/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;1H.
What are the key properties of dibenzofuran;hydrofluoride?
dibenzofuran;hydrofluoride has a molecular weight of 188.20 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran;hydrofluoride is sourced from PubChem (CID 158307405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).