About methylidene(xanthen-9-ylidene)-λ4-sulfane
methylidene(xanthen-9-ylidene)-λ4-sulfane (PubChem CID 101030051) has the molecular formula C14H10OS
and a molecular weight of 226.30 g/mol. Its IUPAC name is methylidene(xanthen-9-ylidene)-λ4-sulfane.
Molecular Properties
| Compound Name | methylidene(xanthen-9-ylidene)-λ4-sulfane |
| PubChem CID | 101030051 |
| Molecular Formula | C14H10OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | methylidene(xanthen-9-ylidene)-λ4-sulfane |
| SMILES | C=S=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C14H10OS/c1-16-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H2 |
| InChIKey | GZWYFNAXYSWKJE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methylidene(xanthen-9-ylidene)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidene(xanthen-9-ylidene)-λ4-sulfane?
The IUPAC name of methylidene(xanthen-9-ylidene)-λ4-sulfane (CID 101030051) is methylidene(xanthen-9-ylidene)-λ4-sulfane.
What is the SMILES notation for methylidene(xanthen-9-ylidene)-λ4-sulfane?
The canonical SMILES for methylidene(xanthen-9-ylidene)-λ4-sulfane is C=S=c1c2ccccc2oc2ccccc12.
What is the InChIKey of methylidene(xanthen-9-ylidene)-λ4-sulfane?
The InChIKey is GZWYFNAXYSWKJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10OS/c1-16-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H2.
What are the key properties of methylidene(xanthen-9-ylidene)-λ4-sulfane?
methylidene(xanthen-9-ylidene)-λ4-sulfane has a molecular weight of 226.30 g/mol, XLogP of 4.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylidene(xanthen-9-ylidene)-λ4-sulfane is sourced from PubChem (CID 101030051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).