About propane;xanthen-9-one
propane;xanthen-9-one (PubChem CID 90876458) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is propane;xanthen-9-one.
Molecular Properties
| Compound Name | propane;xanthen-9-one |
| PubChem CID | 90876458 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | propane;xanthen-9-one |
| SMILES | CCC.CCC.O=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C13H8O2.2C3H8/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;2*1-3-2/h1-8H;2*3H2,1-2H3 |
| InChIKey | JDBPSNVEBWKFES-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze propane;xanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;xanthen-9-one?
The IUPAC name of propane;xanthen-9-one (CID 90876458) is propane;xanthen-9-one.
What is the SMILES notation for propane;xanthen-9-one?
The canonical SMILES for propane;xanthen-9-one is CCC.CCC.O=c1c2ccccc2oc2ccccc12.
What is the InChIKey of propane;xanthen-9-one?
The InChIKey is JDBPSNVEBWKFES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O2.2C3H8/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;2*1-3-2/h1-8H;2*3H2,1-2H3.
What are the key properties of propane;xanthen-9-one?
propane;xanthen-9-one has a molecular weight of 284.40 g/mol, XLogP of 5.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;xanthen-9-one is sourced from PubChem (CID 90876458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).