About trifluoromethanesulfonic acid;xanthen-9-one
trifluoromethanesulfonic acid;xanthen-9-one (PubChem CID 161488852) has the molecular formula C14H9F3O5S
and a molecular weight of 346.28 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;xanthen-9-one.
Molecular Properties
| Compound Name | trifluoromethanesulfonic acid;xanthen-9-one |
| PubChem CID | 161488852 |
| Molecular Formula | C14H9F3O5S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | trifluoromethanesulfonic acid;xanthen-9-one |
| SMILES | O=S(=O)(O)C(F)(F)F.O=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C13H8O2.CHF3O3S/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7) |
| InChIKey | WFIKUFWAUNLHPN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonic acid;xanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonic acid;xanthen-9-one?
The IUPAC name of trifluoromethanesulfonic acid;xanthen-9-one (CID 161488852) is trifluoromethanesulfonic acid;xanthen-9-one.
What is the SMILES notation for trifluoromethanesulfonic acid;xanthen-9-one?
The canonical SMILES for trifluoromethanesulfonic acid;xanthen-9-one is O=S(=O)(O)C(F)(F)F.O=c1c2ccccc2oc2ccccc12.
What is the InChIKey of trifluoromethanesulfonic acid;xanthen-9-one?
The InChIKey is WFIKUFWAUNLHPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O2.CHF3O3S/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7).
What are the key properties of trifluoromethanesulfonic acid;xanthen-9-one?
trifluoromethanesulfonic acid;xanthen-9-one has a molecular weight of 346.28 g/mol, XLogP of 3.34, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonic acid;xanthen-9-one is sourced from PubChem (CID 161488852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).