C15H12O7S — CID 118009267
3-hydroxy-2-phenylchromen-4-one;sulfuric acid (PubChem CID 118009267) has the molecular formula C15H12O7S and a molecular weight of 336.32 g/mol. Its IUPAC name is 3-hydroxy-2-phenylchromen-4-one;sulfuric acid.
| Compound Name | 3-hydroxy-2-phenylchromen-4-one;sulfuric acid |
|---|---|
| PubChem CID | 118009267 |
| Molecular Formula | C15H12O7S |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 3-hydroxy-2-phenylchromen-4-one;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=c1c(O)c(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C15H10O3.H2O4S/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10;1-5(2,3)4/h1-9,17H;(H2,1,2,3,4) |
| InChIKey | XKKHPXOXXBWORN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|