C31H26CoN2O5 — CID 135405100
cobalt;3-hydroxy-2-phenylchromen-4-one;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol (PubChem CID 135405100) has the molecular formula C31H26CoN2O5 and a molecular weight of 565.49 g/mol. Its IUPAC name is cobalt;3-hydroxy-2-phenylchromen-4-one;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol.
| Compound Name | cobalt;3-hydroxy-2-phenylchromen-4-one;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 135405100 |
| Molecular Formula | C31H26CoN2O5 |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | cobalt;3-hydroxy-2-phenylchromen-4-one;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
| SMILES | O=c1c(O)c(-c2ccccc2)oc2ccccc12.Oc1ccccc1/C=N/CC/N=C/c1ccccc1O.[Co] |
| InChI | InChI=1S/C16H16N2O2.C15H10O3.Co/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10;/h1-8,11-12,19-20H,9-10H2;1-9,17H;/b17-11+,18-12+;; |
| InChIKey | UGZYVIOTSMFBOX-SNTCFBDDSA-N |
| XLogP | 5.80 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|