C16H16MnN2O2+2 — CID 135568472
2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;manganese(2+) (PubChem CID 135568472) has the molecular formula C16H16MnN2O2+2 and a molecular weight of 323.25 g/mol. Its IUPAC name is 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;manganese(2+).
| Compound Name | 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;manganese(2+) |
|---|---|
| PubChem CID | 135568472 |
| Molecular Formula | C16H16MnN2O2+2 |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;manganese(2+) |
| SMILES | Oc1ccccc1/C=N/CC/N=C/c1ccccc1O.[Mn+2] |
| InChI | InChI=1S/C16H16N2O2.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/q;+2/b17-11+,18-12+; |
| InChIKey | NTVWCXCBGJMISE-OYJDLGDISA-N |
| XLogP | 2.63 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|