C17H18Cl2N2O2Ti — CID 135852922
dichlorotitanium;2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol (PubChem CID 135852922) has the molecular formula C17H18Cl2N2O2Ti and a molecular weight of 401.12 g/mol. Its IUPAC name is dichlorotitanium;2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol.
| Compound Name | dichlorotitanium;2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol |
|---|---|
| PubChem CID | 135852922 |
| Molecular Formula | C17H18Cl2N2O2Ti |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | dichlorotitanium;2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol |
| SMILES | Cl[Ti]Cl.Oc1ccccc1/C=N\CCC/N=C/c1ccccc1O |
| InChI | InChI=1S/C17H18N2O2.2ClH.Ti/c20-16-8-3-1-6-14(16)12-18-10-5-11-19-13-15-7-2-4-9-17(15)21;;;/h1-4,6-9,12-13,20-21H,5,10-11H2;2*1H;/q;;;+2/p-2/b18-12-,19-13+;;; |
| InChIKey | TUJWZIODHILJBV-MWPTWBDRSA-L |
| XLogP | 4.40 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|