C11H15NOSe — CID 136817271
2-(3-methylselanylpropyliminomethyl)phenol (PubChem CID 136817271) has the molecular formula C11H15NOSe and a molecular weight of 256.21 g/mol. Its IUPAC name is 2-(3-methylselanylpropyliminomethyl)phenol.
| Compound Name | 2-(3-methylselanylpropyliminomethyl)phenol |
|---|---|
| PubChem CID | 136817271 |
| Molecular Formula | C11H15NOSe |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-(3-methylselanylpropyliminomethyl)phenol |
| SMILES | C[Se]CCC/N=C/c1ccccc1O |
| InChI | InChI=1S/C11H15NOSe/c1-14-8-4-7-12-9-10-5-2-3-6-11(10)13/h2-3,5-6,9,13H,4,7-8H2,1H3/b12-9+ |
| InChIKey | WLZVFTCCGSDZKS-FMIVXFBMSA-N |
| XLogP | 2.37 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|