C20H26N2O3V — CID 5242411
oxovanadium;bis(2-(propyliminomethyl)phenol) (PubChem CID 5242411) has the molecular formula C20H26N2O3V and a molecular weight of 393.38 g/mol. Its IUPAC name is oxovanadium;bis(2-(propyliminomethyl)phenol).
| Compound Name | oxovanadium;bis(2-(propyliminomethyl)phenol) |
|---|---|
| PubChem CID | 5242411 |
| Molecular Formula | C20H26N2O3V |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | oxovanadium;bis(2-(propyliminomethyl)phenol) |
| SMILES | CCC/N=C/c1ccccc1O.CCC/N=C/c1ccccc1O.O=[V] |
| InChI | InChI=1S/2C10H13NO.O.V/c2*1-2-7-11-8-9-5-3-4-6-10(9)12;;/h2*3-6,8,12H,2,7H2,1H3;;/b2*11-8+;; |
| InChIKey | YGDUFLDGOAGACG-WRGLMQMPSA-N |
| XLogP | 4.32 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|