C10H12NNaO — CID 102119842
sodium 2-(propyliminomethyl)phenolate (PubChem CID 102119842) has the molecular formula C10H12NNaO and a molecular weight of 185.20 g/mol. Its IUPAC name is sodium 2-(propyliminomethyl)phenolate.
| Compound Name | sodium 2-(propyliminomethyl)phenolate |
|---|---|
| PubChem CID | 102119842 |
| Molecular Formula | C10H12NNaO |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | sodium 2-(propyliminomethyl)phenolate |
| SMILES | CCC/N=C/c1ccccc1[O-].[Na+] |
| InChI | InChI=1S/C10H13NO.Na/c1-2-7-11-8-9-5-3-4-6-10(9)12;/h3-6,8,12H,2,7H2,1H3;/q;+1/p-1/b11-8+; |
| InChIKey | AWAUNGSXRCRIOW-YGCVIUNWSA-M |
| XLogP | -1.41 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|